A4393512
2-Fluoro-3-(trifluoromethyl)benzoyl Chloride , >98.0%(GC)(T) , 208173-19-7
CAS NO.:208173-19-7
Empirical Formula: C8H3ClF4O
Molecular Weight: 226.56
MDL number: MFCD00061154
EINECS: 200-258-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB132.00 | In Stock |
|
| 5G | RMB487.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 193 °C(lit.) |
| Density | 1.517 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 215 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| Specific Gravity | 1.517 |
| color | Clear, almost colourless |
| Sensitive | Moisture Sensitive |
| BRN | 7992377 |
| InChI | 1S/C8H3ClF4O/c9-7(14)4-2-1-3-5(6(4)10)8(11,12)13/h1-3H |
| InChIKey | RIKGRFSGIOOYEK-UHFFFAOYSA-N |
| SMILES | Fc1c(cccc1C(F)(F)F)C(Cl)=O |
| CAS DataBase Reference | 208173-19-7(CAS DataBase Reference) |
Description and Uses
2-Fluoro-3-trifluoromethylbenzoyl Chloride, is a building block used for the synthesis of more complex pharmaceutical and biologically active compounds. It can be used for the synthesis of highly potent novel ketoamide-based cathepsin S inhibitors.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 23-26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29163990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







