A5352612
3-Methylbenzyl chloride , 98% , 620-19-9
Synonym(s):
α-Chloro-m-xylene
CAS NO.:620-19-9
Empirical Formula: C8H9Cl
Molecular Weight: 140.61
MDL number: MFCD00000909
EINECS: 210-628-9
| Pack Size | Price | Stock | Quantity |
| 25G | RMB44.80 | In Stock |
|
| 100G | RMB123.20 | In Stock |
|
| 500G | RMB429.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -41.95°C (estimate) |
| Boiling point: | 195-196 °C(lit.) |
| Density | 1.064 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 168 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | Clear colorless to slightly yellow |
| Water Solubility | Insoluble |
| Merck | 14,10091 |
| BRN | 2040357 |
| InChI | InChI=1S/C8H9Cl/c1-7-3-2-4-8(5-7)6-9/h2-5H,6H2,1H3 |
| InChIKey | LZBOHNCMCCSTJX-UHFFFAOYSA-N |
| SMILES | C1(CCl)=CC=CC(C)=C1 |
| CAS DataBase Reference | 620-19-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-(chloromethyl)-3-methyl-(620-19-9) |
Description and Uses
Intermediate.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P261-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37-36/37/38 |
| Safety Statements | 23-26-27-36/37/39-45-37/39 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 2 |
| Hazard Note | Irritant/Corrosive |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29036990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B STOT SE 3 |







