A5597212
3-Methylbenzyl Alcohol , >98.0%(GC) , 587-03-1
CAS NO.:587-03-1
Empirical Formula: C8H10O
Molecular Weight: 122.16
MDL number: MFCD00004646
EINECS: 209-595-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.00 | In Stock |
|
| 25G | RMB149.60 | In Stock |
|
| 100G | RMB518.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <-20 °C |
| Boiling point: | 215 °C740 mm Hg(lit.) |
| Density | 1.015 g/mL at 25 °C(lit.) |
| refractive index | n |
| RTECS | DA4937010 |
| Flash point: | 222 °F |
| storage temp. | Store at room temperature |
| pka | 14.63±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.02 |
| BRN | 2324516 |
| Henry's Law Constant | 2.2×101 mol/(m3Pa) at 25℃, Wang et al. (2017) |
| InChI | InChI=1S/C8H10O/c1-7-3-2-4-8(5-7)6-9/h2-5,9H,6H2,1H3 |
| InChIKey | JJCKHVUTVOPLBV-UHFFFAOYSA-N |
| SMILES | C1(CO)=CC=CC(C)=C1 |
| LogP | 1.600 |
| CAS DataBase Reference | 587-03-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Methylbenzyl alcohol(587-03-1) |
Description and Uses
3-Methylbenzyl Alcohol is useful for the synthesis of dialkyl aryl phosphates and dialkyl arylalkyl phosphates which possesses inhibitory activities against acetylcholinesterase (AChE) and butyrylchlorinesterase (BChE).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280a-P305+P351+P338-P321-P332+P313-P337+P313 |
| PPE | Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-24/25 |
| WGK Germany | 3 |
| HS Code | 29062990 |
| Storage Class | 10 - Combustible liquids |






