![1-Fluoropyridinium Tetrafluoroborate [Fluorinating Reagent]](https://img.chemicalbook.com/CAS/GIF/107264-09-5.gif)
A4407512
1-Fluoropyridinium Tetrafluoroborate [Fluorinating Reagent] , >95.0%(T) , 107264-09-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB255.20 | In Stock |
|
| 5G | RMB895.20 | In Stock |
|
| 25G | RMB2287.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-192 °C (lit.) |
| storage temp. | Storage temp. 2-8°C |
| form | Powder |
| color | Off-white |
| Sensitive | Moisture Sensitive |
| BRN | 4281226 |
| InChI | 1S/C5H5FN.BF4/c6-7-4-2-1-3-5-7;2-1(3,4)5/h1-5H;/q+1;-1 |
| InChIKey | PIGQKECRKGMXRG-UHFFFAOYSA-N |
| SMILES | F[B-](F)(F)F.F[n+]1ccccc1 |
| CAS DataBase Reference | 107264-09-5(CAS DataBase Reference) |
Description and Uses
1-Fluoropyridine tetrafluoroborate is a pyridine organic compound, which can be used as an intermediate in pharmaceutical synthesis.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 9-21 |
| Hazard Note | Moisture sensitive/Corrosive |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29333990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
