A4452812
1-{[2-fluoro-6-(trifluoromethyl)phenyl]methyl}-5-iodo-6-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione , 97% , 1150560-54-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB199.20 | In Stock |
|
| 5g | RMB501.60 | In Stock |
|
| 25g | RMB1599.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >190oC (dec.) |
| Density | 1.88±0.1 g/cm3(Predicted) |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | 8.04±0.40(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C13H9F4IN2O2/c1-6-10(18)11(21)19-12(22)20(6)5-7-8(13(15,16)17)3-2-4-9(7)14/h2-4H,5H2,1H3,(H,19,21,22) |
| InChIKey | TZBUKGISILNJCR-UHFFFAOYSA-N |
| SMILES | C1(=O)N(CC2=C(C(F)(F)F)C=CC=C2F)C(C)=C(I)C(=O)N1 |
| LogP | 2 |
Description and Uses
1-{[2-fluoro-6-(trifluoromethyl)phenyl]methyl}-5-iodo-6-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione is an intermediate in the synthesis of Elagolix, a gonadotropin-releasing hormone antagonist (GnRH) used in the treatment of endometriosis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P280-P301+P312-P302+P352-P305+P351+P338 |

![1-{[2-fluoro-6-(trifluoromethyl)phenyl]methyl}-5-iodo-6-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione](https://img.chemicalbook.com/CAS/GIF/1150560-54-5.gif)





