LN1283127
≥95% , 830346-50-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB6080.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 625.7±65.0 °C(Predicted) |
| Density | 1.357±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | Dichloromethane; Ethyl Acetate; Methanol |
| pka | 8.49±0.10(Predicted) |
| InChIKey | AEOBYHAZFRJFPZ-QFIPXVFZSA-N |
| SMILES | C1(=O)N(CC2=C(C(F)(F)F)C=CC=C2F)C(C)=C(C2=CC=CC(OC)=C2F)C(=O)N1C[C@H](N)C1=CC=CC=C1 |
Description and Uses
Desbutyrate Elagolix is an intermediate for the synthesis of Elagolix-d6 Sodium Salt (E501016), which is the labelled analogue of Elagolix Sodium Salt (E501018), a novel uracil phenylethylamine that acts as potent human gonadotropin-releasing hormone receptor (hGnRH-R) antagonist.


![1-{[2-fluoro-6-(trifluoromethyl)phenyl]methyl}-5-iodo-6-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione](https://img.chemicalbook.com/CAS/GIF/1150560-54-5.gif)



