BD0542445
5-Bromo-1-(2-fluoro-6-(trifluoromethyl)benzyl)-6-methylpyrimidine-2,4(1H,3H)-dione , 95% , 830346-48-0
CAS NO.:830346-48-0
Empirical Formula: C13H9BrF4N2O2
Molecular Weight: 381.12
MDL number: MFCD12546646
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB27.20 | In Stock |
|
| 1g | RMB43.20 | In Stock |
|
| 5g | RMB142.40 | In Stock |
|
| 25g | RMB486.40 | In Stock |
|
| 100g | RMB1604.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >230°C (dec.) |
| Density | 1.684±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Methanol (Slightly) |
| pka | 7.83±0.40(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C13H9BrF4N2O2/c1-6-10(14)11(21)19-12(22)20(6)5-7-8(13(16,17)18)3-2-4-9(7)15/h2-4H,5H2,1H3,(H,19,21,22) |
| InChIKey | RDQPTRWUBKZZFJ-UHFFFAOYSA-N |
| SMILES | C1(=O)N(CC2=C(C(F)(F)F)C=CC=C2F)C(C)=C(Br)C(=O)N1 |
Description and Uses
5-Bromo-1-[2-Fluoro-6-(trifluoromethyl)benzyl]-6-methylpyrimidine-2,4(1H,3H)-dione is an intermediate in the synthesis of Elagolix, a gonadotropin-releasing hormone antagonist (GnRH) used in the treatment of endometriosis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |



![1-{[2-fluoro-6-(trifluoromethyl)phenyl]methyl}-5-iodo-6-methyl-1,2,3,4-tetrahydropyrimidine-2,4-dione](https://img.chemicalbook.com/CAS/GIF/1150560-54-5.gif)



