A4596929
Ethyl 3-nitrobenzoylacetate , 97% , 52119-38-7
CAS NO.:52119-38-7
Empirical Formula: C11H11NO5
Molecular Weight: 237.21
MDL number: MFCD00126483
EINECS: 257-670-4
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB51.20 | In Stock |
|
| 1g | RMB124.80 | In Stock |
|
| 5g | RMB399.20 | In Stock |
|
| 25G | RMB744.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 75-77 °C (lit.) |
| Boiling point: | 314.4±17.0 °C(Predicted) |
| Density | 1.276±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder |
| pka | 9.52±0.46(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | 1S/C11H11NO5/c1-2-17-11(14)7-10(13)8-4-3-5-9(6-8)12(15)16/h3-6H,2,7H2,1H3 |
| InChIKey | DSOJMGUVLXTQSE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cccc(c1)[N+]([O-])=O |
| CAS DataBase Reference | 52119-38-7(CAS DataBase Reference) |
Description and Uses
Ethyl (3-Nitrobenzoyl)acetate is used in the preparation of Dithiolethiones and identification of potential neuroprotective Agents
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P280-P261-P271 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2918300090 |
| Storage Class | 11 - Combustible Solids |






