A4625312
Glycodeoxycholic acid monohydrate , 97% , 360-65-6
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB220.00 | In Stock |
|
| 500MG | RMB428.00 | In Stock |
|
| 1g | RMB606.40 | In Stock |
|
| 5g | RMB1587.20 | In Stock |
|
| 25g | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 184 °C |
| Boiling point: | 655.6±50.0 °C(Predicted) |
| Density | 1.162±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Acetonitrile (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | pKa 3.87±0.06(H2O,t = 25.0±0.1,I=0.00) (Uncertain) |
| color | White to Off-White |
| InChIKey | WVULKSPCQVQLCU-XHOVQGJQNA-N |
| SMILES | C[C@]12[C@H](C[C@]3([H])[C@]4(CC[C@@H](O)C[C@@]4([H])CC[C@@]3([H])[C@]1([H])CC[C@]2([H])[C@H](C)CCC(=O)NCC(=O)O)C)O |&1:1,2,4,6,9,12,16,18,22,24,r| |
Description and Uses
Glycodeoxycholic Acid is a bile acid that induces severe pancreatitis in rats.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| RTECS | MB9670000 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |
| Toxicity | mouse,LD50,intravenous,140mg/kg (140mg/kg),Arzneimittel-Forschung. Drug Research. Vol. 20, Pg. 323, 1970. |





