PRODUCT Properties
| Melting point: | -80°C |
| Boiling point: | 118 °C |
| Density | 0.873 g/mL at 25 °C |
| refractive index | n |
| Flash point: | 117 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 13.28±0.20(Predicted) |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| BRN | 1739419 |
| InChI | InChI=1S/C6H10O/c1-3-5-6(7)4-2/h2,6-7H,3,5H2,1H3 |
| InChIKey | LTFTWJYRQNTCHI-UHFFFAOYSA-N |
| SMILES | C#CC(O)CCC |
| CAS DataBase Reference | 105-31-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Hexyn-3-ol (105-31-7) |
Description and Uses
Corrosion inhibitor against mineral acids, hightemperature oil-well-acidizing inhibitor.
Safety
| Symbol(GHS) | ![]() ![]() ![]() GHS02,GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H226-H301-H310-H318 |
| Precautionary statements | P210-P262-P280-P301+P310+P330-P302+P352+P310-P305+P351+P338+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T+ |
| Risk Statements | 10-25-27-41 |
| Safety Statements | 26-28-36/37/39-45 |
| RIDADR | UN 2929 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | MR0181000 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29052900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Flam. Liq. 3 |
| Toxicity | mouse,LD50,intravenous,56mg/kg (56mg/kg),U.S. Army Armament Research & Development Command, Chemical Systems Laboratory, NIOSH Exchange Chemicals. Vol. NX#00219, |









