T9356930
Mestranol , >98.0%(T)(HPLC) , 72-33-3
Synonym(s):
(17α)-3-Methoxy-19-norpregna-1,3,5(10)-trien-20-yn-17-ol;17α-Ethynyl-1,3,5(10)-estratriene-3,17β-diol 3-methyl ether;17α-Ethynylestradiol 3-methyl ether;3-Methoxy-17α-ethynylestradiol;NSC 84032
CAS NO.:72-33-3
Empirical Formula: C21H26O2
Molecular Weight: 310.43
MDL number: MFCD00003689
EINECS: 200-777-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB612.00 | In Stock |
|
| 5g | RMB2024.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 153-155 °C(lit.) |
| Boiling point: | 390.58°C (rough estimate) |
| alpha | +2~+8°(D/20℃)(c=1, 1,4-dioxane) |
| Density | 1.0865 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | Acetonitrile: 1 mg/ml; Ethanol: 1 mg/ml; Methanol: 1 mg/ml |
| form | Solid |
| pka | 13.10±0.40(Predicted) |
| color | White to off-white |
| optical activity | [α]15/D +3°, c = 2 in dioxane |
| Merck | 5917 |
| BRN | 2625905 |
| InChI | 1S/C21H26O2/c1-4-21(22)12-10-19-18-7-5-14-13-15(23-3)6-8-16(14)17(18)9-11-20(19,21)2/h1,6,8,13,17-19,22H,5,7,9-12H2,2-3H3/t17-,18-,19+,20+,21+/m1/s1 |
| InChIKey | IMSSROKUHAOUJS-MJCUULBUSA-N |
| SMILES | COc1ccc2C3CC[C@@]4(C)C(CC[C@@]4(O)C#C)C3CCc2c1 |
| CAS DataBase Reference | 72-33-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Mestranol(72-33-3) |
| EPA Substance Registry System | Mestranol (72-33-3) |
Description and Uses
antiemetic
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H315-H319-H351 |
| Precautionary statements | P201-P302+P352-P305+P351+P338-P308+P313 |
| PPE | Eyeshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-40-48-68 |
| Safety Statements | 22-26-36/37/39-45-36/37 |
| WGK Germany | 3 |
| RTECS | RC8960000 |
| HS Code | 29372900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 Eye Irrit. 2 Skin Irrit. 2 |
| Hazardous Substances Data | 72-33-3(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: > 10gm/kg |








