A4709812
(S)-1-Boc-3-Hydroxypyrrolidine , 98% , 101469-92-5
Synonym(s):
(S)-N-(tert-Butoxycarbonyl)-(+)-3-pyrrolidinol
CAS NO.:101469-92-5
Empirical Formula: C9H17NO3
Molecular Weight: 187.24
MDL number: MFCD01317839
EINECS: 600-216-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB20.00 | In Stock |
|
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB38.40 | In Stock |
|
| 25G | RMB112.00 | In Stock |
|
| 100G | RMB444.80 | In Stock |
|
| 500g | RMB2159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-64 °C (lit.) |
| Boiling point: | 273.3±33.0 °C(Predicted) |
| alpha | 26 º (c=1%, MeOH) |
| Density | 1.142±0.06 g/cm3(Predicted) |
| refractive index | 27 ° (C=1, MeOH) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| pka | 14.74±0.20(Predicted) |
| form | Crystalline Powder |
| color | White to pale yellow |
| optical activity | [α]20/D +26°, c = 1% in methanol |
| BRN | 6271108 |
| InChI | InChI=1S/C9H17NO3/c1-9(2,3)13-8(12)10-5-4-7(11)6-10/h7,11H,4-6H2,1-3H3/t7-/m0/s1 |
| InChIKey | APCBTRDHCDOPNY-ZETCQYMHSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CC[C@H](O)C1 |
| CAS DataBase Reference | 101469-92-5(CAS DataBase Reference) |
Description and Uses
(S)-(+)-N-Boc-3-pyrrolidinol can be used as a reactant to synthesize:
- tert-Butyl 3-(2-bromophenoxy)pyrrolidine-1-carboxylate, which is employed as a key intermediate in the preparation of IkB-kinase IKK2 inhibitor.
- Dimethoxy-pyrrolidylquinazoline , and peptidomimetic quinoline derivatives.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | T,Xi |
| Risk Statements | 25-37/38-41-R41-R37/38-R25 |
| Safety Statements | 26-39-45-S45-S39-S26 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 29339900 |







