PRODUCT Properties
| Melting point: | 164-166 °C (lit.) |
| Boiling point: | 264 °C (lit.) |
| Density | 1,063 g/cm3 |
| refractive index | 1.4842 |
| Flash point: | 265°C |
| storage temp. | Store at room temperature |
| form | Crystalline Powder or Crystals, Needles |
| color | White to light yellow |
| Water Solubility | Insoluble in water |
| BRN | 1905834 |
| InChI | InChI=1S/C12H18/c1-7-8(2)10(4)12(6)11(5)9(7)3/h1-6H3 |
| InChIKey | YUWFEBAXEOLKSG-UHFFFAOYSA-N |
| SMILES | C1(C)=C(C)C(C)=C(C)C(C)=C1C |
| CAS DataBase Reference | 87-85-4(CAS DataBase Reference) |
| EPA Substance Registry System | Hexamethylbenzene (87-85-4) |
Description and Uses
Hexamethylbenzene is used as pharmaceutical intermediates, in organic synthesis of compounds, as a solvent for He-NMR spectroscopy. Used as a ligand in organometallic chemistry. Reaction with dimethyldioxirane, gives the major product, an unusual oxepane triepoxide.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS05 |
| Signal word | Warning |
| Hazard statements | H413 |
| Precautionary statements | P501-P273 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | DA3200000 |
| TSCA | TSCA listed |
| HS Code | 29029090 |
| Storage Class | 11 - Combustible Solids |







