A4734612
2-Hydroxy-4-methylpyridine , 98% , 13466-41-6
Synonym(s):
4-Methyl-2(1H)-pyridinone
CAS NO.:13466-41-6
Empirical Formula: C6H7NO
Molecular Weight: 109.13
MDL number: MFCD00134298
EINECS: 627-289-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB25.60 | In Stock |
|
| 5G | RMB64.80 | In Stock |
|
| 25G | RMB201.60 | In Stock |
|
| 100G | RMB628.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 131-134 °C (lit.) |
| Boiling point: | 186-187 °C/12 mmHg (lit.) |
| Density | 1.1143 (rough estimate) |
| refractive index | 1.5444 (estimate) |
| Flash point: | 186-187°C/12mm |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | pK1:4.529(+1) (25°C) |
| color | White to Gray to Brown |
| BRN | 107082 |
| InChI | InChI=1S/C6H7NO/c1-5-2-3-7-6(8)4-5/h2-4H,1H3,(H,7,8) |
| InChIKey | YBDRFJXGJQULGH-UHFFFAOYSA-N |
| SMILES | C1(=O)NC=CC(C)=C1 |
| CAS DataBase Reference | 13466-41-6(CAS DataBase Reference) |
Description and Uses
2-Hydroxy-4-methylpyridine is an intermediate used to prepare oxobenzopyrancarboxylate derivatives as inhibitors of serine proteases and human leukocyte elastase. It is also used in the synthesis of (indanylamino)(pyridinyloxy)pyrazines and analogs as corticotropin releasing factor type-1 receptor antagonists.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-40 |
| Safety Statements | 26-37/39-36-22 |
| WGK Germany | 3 |
| HS Code | 29333995 |





