A4751112
4-Hydroxybenzamidine Hydrochloride , 96% , 38148-63-9
CAS NO.:38148-63-9
Empirical Formula: C7H9ClN2O
Molecular Weight: 172.61
MDL number: MFCD00136405
EINECS: 611-756-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB40.00 | In Stock |
|
| 5G | RMB149.60 | In Stock |
|
| 10g | RMB263.20 | In Stock |
|
| 25G | RMB440.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 223-226 |
| RTECS | CV6262000 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Methanol (Slightly) |
| form | Solid |
| color | White to Pale Beige |
| Water Solubility | Soluble in water. |
| λmax | 305nm(H2O)(lit.) |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C7H8N2O.ClH/c8-7(9)5-1-3-6(10)4-2-5;/h1-4,10H,(H3,8,9);1H |
| InChIKey | VHVJRSVTZPYXEH-UHFFFAOYSA-N |
| SMILES | C1(=CC=C(O)C=C1)C(=N)N.Cl |
| CAS DataBase Reference | 38148-63-9(CAS DataBase Reference) |
Description and Uses
4-Hydroxybenzamidine hydrochloride is used as a pharmaceutical intermediate and used in organic chemical synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
| HS Code | 29252900 |
| Toxicity | mouse,LD50,intravenous,270mg/kg (270mg/kg),Journal of Pharmacology and Experimental Therapeutics. Vol. 84, Pg. 16, 1945. |





