A4756312
4-Hydroxycarbazole , ≥95.0% , 52602-39-8
Synonym(s):
9H-Carbazol-4-ol
CAS NO.:52602-39-8
Empirical Formula: C12H9NO
Molecular Weight: 183.21
MDL number: MFCD02178385
EINECS: 258-034-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB28.80 | In Stock |
|
| 5G | RMB40.80 | In Stock |
|
| 25G | RMB109.60 | In Stock |
|
| 100g | RMB353.60 | In Stock |
|
| 500g | RMB1583.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169-173 °C (lit.) |
| Boiling point: | 431.4±18.0 °C(Predicted) |
| Density | 1.362±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightlty), Methanol (Slightly) |
| pka | 9.87±0.30(Predicted) |
| form | Powder |
| color | Tan to cacao |
| InChI | InChI=1S/C12H9NO/c14-11-7-3-6-10-12(11)8-4-1-2-5-9(8)13-10/h1-7,13-14H |
| InChIKey | UEOHATPGKDSULR-UHFFFAOYSA-N |
| SMILES | N1C2=C(C=CC=C2)C2=C1C=CC=C2O |
| CAS DataBase Reference | 52602-39-8(CAS DataBase Reference) |
Description and Uses
4-Hydroxy Carbazole (cas# 52602-39-8) is a compound useful in organic synthesis.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






