A4778512
4′-Hydroxy-3′-nitroacetophenone , ≥98.0%(GC) , 6322-56-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB25.92 | In Stock |
|
| 25G | RMB46.40 | In Stock |
|
| 100G | RMB157.60 | In Stock |
|
| 250G | RMB291.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 132-135 °C(lit.) |
| Boiling point: | 314.24°C (rough estimate) |
| Density | 1.4283 (rough estimate) |
| refractive index | 1.5468 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Chloroform, Dichloromethane, DMSO, Ethyl Acetate |
| form | powder to crystal |
| pka | 5.18±0.14(Predicted) |
| color | Light yellow to Amber to Dark green |
| BRN | 1959078 |
| InChI | 1S/C8H7NO4/c1-5(10)6-2-3-8(11)7(4-6)9(12)13/h2-4,11H,1H3 |
| InChIKey | MMNKVWGVSHRIJL-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 6322-56-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Hydroxy-3-nitroacetophenone(6322-56-1) |
Description and Uses
4′-Hydroxy-3′-nitroacetophenone may be used in chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-36-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
