A4779012
1H-Pyrazole-3-boronic acid , 98% , 376584-63-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB56.00 | In Stock |
|
| 1G | RMB123.20 | In Stock |
|
| 10g | RMB303.20 | In Stock |
|
| 5G | RMB399.20 | In Stock |
|
| 25g | RMB710.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 85-88°C |
| Boiling point: | 430.4±37.0 °C(Predicted) |
| Density | 1.40±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | solid |
| pka | 8.58±0.53(Predicted) |
| color | Off-white |
| Water Solubility | Soluble in water. |
| InChI | InChI=1S/C3H5BN2O2/c7-4(8)3-1-2-5-6-3/h1-2,7-8H,(H,5,6) |
| InChIKey | NEUWPDLMDVINSN-UHFFFAOYSA-N |
| SMILES | N1C=CC(B(O)O)=N1 |
Description and Uses
Significantly used as synthetic intermediates. They are widely used in the production of optics.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933199090 |
