A4782012
1,1,1,3,3,3-Hexafluoro-2-phenyl-2-propanol , ≥97.0%(GC) , 718-64-9
Synonym(s):
α,α-Bis(trifluoromethyl)benzyl alcohol
CAS NO.:718-64-9
Empirical Formula: C9H6F6O
Molecular Weight: 244.13
MDL number: MFCD00040983
EINECS: 211-943-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB142.40 | In Stock |
|
| 5G | RMB478.40 | In Stock |
|
| 25G | RMB1502.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 160 °C(lit.) |
| Density | 1.45 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 140 °F |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 9.20±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Almost colorless |
| BRN | 2053547 |
| InChI | 1S/C9H6F6O/c10-8(11,12)7(16,9(13,14)15)6-4-2-1-3-5-6/h1-5,16H |
| InChIKey | IZPIZCAYJQCTNG-UHFFFAOYSA-N |
| SMILES | OC(c1ccccc1)(C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 718-64-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenemethanol, .alpha.,.alpha.-bis(trifluoromethyl)- (718-64-9) |
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 1987 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29062990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




![Bis[alpha,alpha-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur](https://img.chemicalbook.com/CAS/GIF/32133-82-7.gif)



