BD9760655
Bis[alpha,alpha-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur , 98% , 32133-82-7
Synonym(s):
Bis[α,α-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur;Bis[α,α-bis(trifluoromethyl)benzyloxy]diphenylsulfur
CAS NO.:32133-82-7
Empirical Formula: C30H20F12O2S
Molecular Weight: 672.52
MDL number: MFCD00010662
| Pack Size | Price | Stock | Quantity |
| 5g | RMB2848.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 106-108 °C(lit.) |
| Density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | Freezer |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Orange to Green |
| BRN | 1416879 |
| Stability: | Extremely Moisture Sensitive |
| InChIKey | RMIBJVUYNZSLSD-UHFFFAOYSA-N |
| SMILES | S(C1=CC=CC=C1)(C1=CC=CC=C1)(OC(C(F)(F)F)(C(F)(F)F)C1=CC=CC=C1)OC(C(F)(F)F)(C(F)(F)F)C1=CC=CC=C1 |
Description and Uses
Versatile dehydrating and oxidizing agent. For chemistry and references, see Aldrichimica Acta .
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29309090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |

![Bis[alpha,alpha-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur](https://img.chemicalbook.com/CAS/GIF/32133-82-7.gif)




