A7435212
(<i>S</i>)-(+)-α-(Trifluoromethyl)benzyl Alcohol , >98.0%(GC) , 340-06-7
Synonym(s):
(+)-Phenyl(trifluoromethyl)carbinol;(S)-(+)-1-Phenyl-2,2,2-trifluoroethanol
CAS NO.:340-06-7
Empirical Formula: C8H7F3O
Molecular Weight: 176.14
MDL number: MFCD00077845
EINECS: 206-430-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB511.20 | In Stock |
|
| 1G | RMB1391.20 | In Stock |
|
| 5g | RMB4943.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 73-76 °C9 mm Hg(lit.) |
| Density | 1.3 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 184 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| pka | 11.91±0.10(Predicted) |
| color | Clear colorless to pale yellow |
| optical activity | [α]20/D +31.3±0.5°, neat |
| BRN | 2327547 |
| InChI | 1S/C8H7F3O/c9-8(10,11)7(12)6-4-2-1-3-5-6/h1-5,7,12H/t7-/m0/s1 |
| InChIKey | VNOMEAQPOMDWSR-ZETCQYMHSA-N |
| SMILES | O[C@@H](c1ccccc1)C(F)(F)F |
Description and Uses
(S)?-?(+)?-?α-?(Trifluoromethyl)?benzyl Alcohol is used in the synthesis of metal-organic framework compounds which may have mesoporous properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| F | 10-23 |
| HS Code | 29062990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






