A3679912
1,3-<WBR>Difluoro-<WBR>2-<WBR>propanol , 99% , 453-13-4
CAS NO.:453-13-4
Empirical Formula: C3H6F2O
Molecular Weight: 96.08
MDL number: MFCD00000452
EINECS: 207-216-6
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 54-55 °C34 mm Hg(lit.) |
| Density | 1.24 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 108 °F |
| storage temp. | Flammables area |
| solubility | soluble in DMSO, Methanol |
| form | Liquid |
| pka | 12.67±0.20(Predicted) |
| color | Clear yellow to brownish |
| BRN | 1732050 |
| InChI | InChI=1S/C3H6F2O/c4-1-3(6)2-5/h3,6H,1-2H2 |
| InChIKey | PVDLUGWWIOGCNH-UHFFFAOYSA-N |
| SMILES | C(F)C(O)CF |
| CAS DataBase Reference | 453-13-4(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propanol, 1,3-difluoro- (453-13-4) |
Description and Uses
1,3-Difluoro-2-propanol was used in the synthesis of 1,3-difluoroacetone.
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | UN 1987 3/PG 3 |
| WGK Germany | 3 |
| RTECS | UB1770000 |
| Hazard Note | Flammable |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29055998 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |







