PRODUCT Properties
| Boiling point: | 60-62 °C (lit.) | 
                                    
| Density | 1.484 g/mL at 25 °C (lit.) | 
                                    
| refractive index | n | 
                                    
| Flash point: | >230 °F | 
                                    
| storage temp. | Refrigerator | 
                                    
| solubility | Chloroform (Soluble), Methanol (Soluble) | 
                                    
| form | liquid | 
                                    
| pka | 9.82±0.29(Predicted) | 
                                    
| color | pale yellow | 
                                    
| Water Solubility | Slightly soluble in water. | 
                                    
| BRN | 1841110 | 
                                    
| Stability: | Volatile | 
                                    
| InChI | InChI=1S/C4H4F6O/c1-2(11,3(5,6)7)4(8,9)10/h11H,1H3 | 
                                    
| InChIKey | FQDXJYBXPOMIBX-UHFFFAOYSA-N | 
                                    
| SMILES | C(F)(F)(F)C(C)(O)C(F)(F)F | 
                                    
| EPA Substance Registry System | 2-Propanol, 1,1,1,3,3,3-hexafluoro-2-methyl- (1515-14-6) | 
                                    
Description and Uses
1,1,1,3,3,3-Hexafluoro-2-methyl-2-propanol is used as a solvent. It is used in the preparation of volatile sodium yttrium and zirconium fluoroalkoxides. It is also used in the synthesis of precursors to per- and polyfluoroethers.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302+H312+H332-H315-H319-H335 | 
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | 
| Hazard Codes | Xn,Xi,F | 
| Risk Statements | 20/21/22-36/37/38 | 
| Safety Statements | 26-36 | 
| WGK Germany | 3 | 
| Hazard Note | Harmful/Irritant | 
| TSCA | T | 
| HazardClass | IRRITANT, FLAMMABLE | 
| HS Code | 29055900 | 




![Bis[alpha,alpha-bis(trifluoromethyl)benzenemethanolato]diphenylsulfur](https://img.chemicalbook.com/CAS/GIF/32133-82-7.gif)


