A1528312
1,3-Bis(hexafluoro-α-hydroxyisopropyl)benzene , >98.0%(GC) , 802-93-7
CAS NO.:802-93-7
Empirical Formula: C12H6F12O2
Molecular Weight: 410.16
MDL number: MFCD00042090
EINECS: 212-354-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB112.00 | In Stock |
|
| 5G | RMB359.20 | In Stock |
|
| 25G | RMB1596.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 9-10°C |
| Boiling point: | 209 °C(lit.) |
| Density | 1.659 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 207 °F |
| solubility | Difficult to mix. |
| pka | 8.61±0.15(Predicted) |
| form | clear liquid |
| Specific Gravity | 1.659 |
| color | Colorless to Almost colorless |
| BRN | 2024879 |
| InChI | InChI=1S/C12H6F12O2/c13-9(14,15)7(25,10(16,17)18)5-2-1-3-6(4-5)8(26,11(19,20)21)12(22,23)24/h1-4,25-26H |
| InChIKey | PGUIOHNOYADLMU-UHFFFAOYSA-N |
| SMILES | C(O)(C(F)(F)F)(C(F)(F)F)C1C=CC=C(C(O)(C(F)(F)F)C(F)(F)F)C=1 |
| EPA Substance Registry System | 1,3-Benzenedimethanol, .alpha.,.alpha.,.alpha.',.alpha.'-tetrakis(trifluoromethyl)- (802-93-7) |
Description and Uses
1,3-Bis(2-hydroxyhexafluoroisopropyl)benzene is used to determine the specific details of electrical magnitudes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| RTECS | 212-354-5 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | IRRITANT, CORROSIVE |
| HS Code | 29062990 |







