PRODUCT Properties
| Melting point: | 126-127°C |
| Boiling point: | 273.8±13.0 °C(Predicted) |
| Density | 1.242±0.06 g/cm3(Predicted) |
| RTECS | UY8715000 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Solid |
| pka | 14.66±0.30(Predicted) |
| color | Light orange to Yellow to Green |
| Water Solubility | Soluble in methanol and chloroform. Slightly soluble in water. |
| λmax | 288nm(lit.) |
| InChI | InChI=1S/C7H6N2/c1-2-6-7(8-4-1)3-5-9-6/h1-5,9H |
| InChIKey | XWIYUCRMWCHYJR-UHFFFAOYSA-N |
| SMILES | C12C=CNC1=CC=CN=2 |
| CAS DataBase Reference | 272-49-1(CAS DataBase Reference) |
Description and Uses
It is an important raw material and intermediate used in organic synthesis agrochemical, pharmaceutical and dyestuff field.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H318 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 41 |
| Safety Statements | 26-39 |
| HazardClass | IRRITANT |
| HS Code | 29339980 |
