PRODUCT Properties
| Melting point: | 164-169 °C(lit.) | 
                                    
| Boiling point: | 254.3±32.0 °C(Predicted) | 
                                    
| Density | 1.222±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| pka | 13.35±0.46(Predicted) | 
                                    
| form | powder to crystal | 
                                    
| color | White to Almost white | 
                                    
| Water Solubility | almost transparency | 
                                    
| InChI | InChI=1S/C3H8N2O2/c4-3(7)5-1-2-6/h6H,1-2H2,(H3,4,5,7) | 
                                    
| InChIKey | CLAHOZSYMRNIPY-UHFFFAOYSA-N | 
                                    
| SMILES | N(CCO)C(N)=O | 
                                    
| CAS DataBase Reference | 2078-71-9(CAS DataBase Reference) | 
                                    
Description and Uses
1-(2-Hydroxyethyl)urea is used as a reactant in the application of fluorous protocols for Ugi and Biginelli multicomponent condensations.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P305+P351+P338 | 
| Risk Statements | 36/37/38 | 
| Safety Statements | 26-36/37/39 | 
| WGK Germany | 3 | 
| RTECS | YT4907000 | 
| HS Code | 2924190090 | 







