PRODUCT Properties
| Melting point: | 164-169 °C(lit.) |
| Boiling point: | 254.3±32.0 °C(Predicted) |
| Density | 1.222±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 13.35±0.46(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | almost transparency |
| Cosmetic Ingredient Review (CIR) | 2-HYDROXYETHYLUREA (2078-71-9) |
| InChI | InChI=1S/C3H8N2O2/c4-3(7)5-1-2-6/h6H,1-2H2,(H3,4,5,7) |
| InChIKey | CLAHOZSYMRNIPY-UHFFFAOYSA-N |
| SMILES | N(CCO)C(N)=O |
| CAS DataBase Reference | 2078-71-9(CAS DataBase Reference) |
Description and Uses
1-(2-Hydroxyethyl)urea is used as a reactant in the application of fluorous protocols for Ugi and Biginelli multicomponent condensations.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| RTECS | YT4907000 |
| HS Code | 2924190090 |
| Storage Class | 11 - Combustible Solids |







