A4783812
4-Hydroxy-3,5-Dimethylbenzonitrile , ≥97.0%(GC) , 4198-90-7
Synonym(s):
4-Cyano-2,6-dimethylphenol
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB76.80 | In Stock |
|
| 100G | RMB294.40 | In Stock |
|
| 500g | RMB1359.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 123-127 °C |
| Boiling point: | 267.28°C (rough estimate) |
| Density | 1.1135 (rough estimate) |
| vapor pressure | 0.005Pa at 25℃ |
| refractive index | 1.5290 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | soluble in Methanol |
| pka | pK1:8.27 (25°C) |
| form | Crystalline Powder |
| color | White to beige |
| Water Solubility | 320mg/L at 20℃ |
| InChI | InChI=1S/C9H9NO/c1-6-3-8(5-10)4-7(2)9(6)11/h3-4,11H,1-2H3 |
| InChIKey | WFYGXOWFEIOHCZ-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(C)=C(O)C(C)=C1 |
| LogP | 1.6 at 20℃ |
| CAS DataBase Reference | 4198-90-7(CAS DataBase Reference) |
Description and Uses
Intermediate in the preparation of HIV replication inhibitors.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H300-H319 |
| Precautionary statements | P264-P270-P280-P301+P310-P305+P351+P338-P337+P313 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xn,Xi |
| Risk Statements | 25-36-32-20/21/22-36/37/38 |
| Safety Statements | 26-45-36/37 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DI4359000 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT |
| HS Code | 29269095 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 |
| Toxicity | mouse,LD50,intraperitoneal,650mg/kg (650mg/kg),Journal of Medicinal and Pharmaceutical Chemistry. Vol. 2, Pg. 201, 1960. |
