A4787712
4,4′-(Hexafluoroisopropylidene)diphthalic anhydride , 99% , 1107-00-2
Synonym(s):
2,2-Bis(3,4-dicarboxyphenyl)-1,1,1,3,3,3-hexafluoropropane;4,4′-(Hexafluoroisopropylidene)bis(phthalic anhydride);4,4′-(Hexafluoroisopropylidene)diphthalic anhydride
CAS NO.:1107-00-2
Empirical Formula: C19H6F6O6
Molecular Weight: 444.24
MDL number: MFCD00039143
EINECS: 214-170-0
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB52.00 | In Stock |
|
| 25G | RMB195.20 | In Stock |
|
| 100G | RMB618.40 | In Stock |
|
| 500g | RMB2749.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 244-247 °C(lit.) |
| Boiling point: | 494.5±45.0 °C(Predicted) |
| Density | 1.697±0.06 g/cm3(Predicted) |
| vapor pressure | 7.7Pa at 20℃ |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Water Solubility | Miscible with water. |
| Sensitive | Moisture Sensitive |
| BRN | 7057916 |
| InChI | InChI=1S/C19H6F6O6/c20-18(21,22)17(19(23,24)25,7-1-3-9-11(5-7)15(28)30-13(9)26)8-2-4-10-12(6-8)16(29)31-14(10)27/h1-6H |
| InChIKey | QHHKLPCQTTWFSS-UHFFFAOYSA-N |
| SMILES | C(C1C=CC2C(=O)OC(=O)C=2C=1)(C1C=CC2C(=O)OC(=O)C=2C=1)(C(F)(F)F)C(F)(F)F |
| LogP | 5.59 at 25℃ |
| CAS DataBase Reference | 1107-00-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Isobenzofurandione, 5,5'-[2,2,2-trifluoro-1-(trifluoromethyl)ethylidene]bis- (1107-00-2) |
Description and Uses
4,4'-(Hexafluoroisopropylidene)diphthalic anhydride (6FDA) is an aromatic organofluorine compound that is utilized as a dianhydride monomer. It is among the most frequently used dianhydride monomers due to its exceptional balance of mechanical and electrical properties. It is particularly prominent in the construction of colorless and transparent polyimides.
4,4'-(Hexafluoroisopropylidene) diphthalic anhydride is involved in the synthesis of polyamides derived from terphenylenes, which is used for gas separation.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H314-H335 |
| Precautionary statements | P260-P271-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C,Xi |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 1 |
| F | 21 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29173990 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |






