A4791012
3′-Hydroxy-4′-methoxyacetophenone , 97% , 6100-74-9
Synonym(s):
1-(3-hydroxy-4-methoxyphenyl)ethanone
| Pack Size | Price | Stock | Quantity |
| 1G | RMB71.20 | In Stock |
|
| 5G | RMB279.20 | In Stock |
|
| 25g | RMB1095.20 | In Stock |
|
| 100g | RMB3063.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-92 °C |
| Boiling point: | 329.9±27.0 °C(Predicted) |
| Density | 1.158 |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 9.15±0.10(Predicted) |
| color | Off-White to Yellow |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C9H10O3/c1-6(10)7-3-4-9(12-2)8(11)5-7/h3-5,11H,1-2H3 |
| InChIKey | YLTGFGDODHXMFB-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(OC)C(O)=C1)C |
| LogP | 1.373 (est) |
Description and Uses
Isoacetovanillone (Diosmin EP Impurity A) is a volatile compound isolated from oak wood. Also a byproduct in the production of Acetovanillone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | 3 |
| HS Code | 2914390090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







