A4798712
4-Hydroxy-3-nitrobenzaldehyde , >97.0%(GC) , 3011-34-5
CAS NO.:3011-34-5
Empirical Formula: C7H5NO4
Molecular Weight: 167.12
MDL number: MFCD00007117
EINECS: 221-141-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB29.60 | In Stock |
|
| 25G | RMB68.00 | In Stock |
|
| 100G | RMB196.00 | In Stock |
|
| 500g | RMB728.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-142 °C (lit.) |
| Boiling point: | 295.67°C (rough estimate) |
| Density | 1.5216 (rough estimate) |
| refractive index | 1.6280 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.99±0.14(Predicted) |
| form | Powder |
| color | light yellow |
| Sensitive | Air Sensitive |
| BRN | 2047884 |
| Henry's Law Constant | 9.4×100 mol/(m3Pa) at 25℃, Schwarzenbach et al. (1988) |
| InChI | InChI=1S/C7H5NO4/c9-4-5-1-2-7(10)6(3-5)8(11)12/h1-4,10H |
| InChIKey | YTHJCZRFJGXPTL-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC=C(O)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 3011-34-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Hydroxy-3-nitrobenzaldehyde(3011-34-5) |
Description and Uses
4-Hydroxy-3-nitrobenzaldehyde was used in the synthesis of:
- 4-hydroxy-3-nitrocinnamic acid
- solvated benzohydrazone derivatives: N′-(4-hydroxy-3-nitrobenzylidene)-3-methylbenzohydrazide-methanol-water
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT, AIR SENSITIVE |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |





