A4803712
6-Hydroxy-5-nitronicotinic Acid , >97.0%(HPLC)(T) , 6635-31-0
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB45.60 | In Stock |
|
| 1G | RMB48.00 | In Stock |
|
| 5G | RMB105.84 | In Stock |
|
| 25g | RMB255.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 269-271 |
| Boiling point: | 363.6±42.0 °C(Predicted) |
| Density | 1.70±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 3.09±0.50(Predicted) |
| color | Light yellow to Yellow |
| BRN | 177986 |
| InChI | InChI=1S/C6H4N2O5/c9-5-4(8(12)13)1-3(2-7-5)6(10)11/h1-2H,(H,7,9)(H,10,11) |
| InChIKey | VJMXJGVEVASJOD-UHFFFAOYSA-N |
| SMILES | C1NC(=O)C([N+]([O-])=O)=CC=1C(O)=O |
| CAS DataBase Reference | 6635-31-0(CAS DataBase Reference) |
Description and Uses
6-Hydroxy-5-nitronicotinic acid is mainly used as an antibacterial agent and pharmaceutical intermediate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Hazard Note | Irritant/Keep Cold |
| HazardClass | IRRITANT |
| HS Code | 2933399990 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 STOT SE 3 |
