A4804112
1<i>H</i>,1<i>H</i>,5<i>H</i>-Octafluoropentyl Methacrylate (stabilized with MEHQ) , >98.0%(GC) , 355-93-1
Synonym(s):
OFPMA
CAS NO.:355-93-1
Empirical Formula: C9H8F8O2
Molecular Weight: 300.15
MDL number: MFCD00039278
EINECS: 206-596-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB157.60 | In Stock |
|
| 25G | RMB561.60 | In Stock |
|
| 100g | RMB2055.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 8-12°C |
| Boiling point: | 88 °C/40 mmHg (lit.) |
| Density | 1.432 g/mL at 25 °C (lit.) |
| vapor pressure | 12.41hPa at 25.5℃ |
| refractive index | n |
| Flash point: | 178 °F |
| storage temp. | Keep Cold |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.50 |
| Water Solubility | 30mg/L at 20℃ |
| BRN | 1801409 |
| Cosmetics Ingredients Functions | BINDING |
| InChI | 1S/C9H8F8O2/c1-4(2)5(18)19-3-7(12,13)9(16,17)8(14,15)6(10)11/h6H,1,3H2,2H3 |
| InChIKey | ZNJXRXXJPIFFAO-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| LogP | 3.03 at 35℃ |
| CAS DataBase Reference | 355-93-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1h,1h,5h-Octafluoropentyl methacrylate(355-93-1) |
| EPA Substance Registry System | 1H,1H,5H-Perfluoropentyl methacrylate (355-93-1) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi,F |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Keep Cold |
| HazardClass | KEEP COLD, FLAMMABLE |
| HS Code | 29161400 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






