A4809412
Hexanophenone , >98.0%(GC) , 942-92-7
Synonym(s):
Amyl phenyl ketone
CAS NO.：942-92-7
Empirical Formula: C12H16O
Molecular Weight: 176.25
MDL number: MFCD00009512
EINECS: 213-394-6
| Pack Size | Price | Stock | Quantity |
| 5g | RMB98.40 | In Stock |
|
| 25G | RMB325.60 | In Stock |
|
| 100g | RMB849.60 | In Stock |
|
| 500G | RMB2974.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25-26 °C (lit.) |
| Boiling point: | 265 °C (lit.) |
| Density | 0.958 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid After Melting |
| color | Clear light yellow |
| BRN | 1908667 |
| InChI | InChI=1S/C12H16O/c1-2-3-5-10-12(13)11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3 |
| InChIKey | MAHPVQDVMLWUAG-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC=C1)(=O)CCCCC |
| LogP | 3.790 (est) |
| CAS DataBase Reference | 942-92-7(CAS DataBase Reference) |
| EPA Substance Registry System | Hexanophenone (942-92-7) |
Description and Uses
Caprophenone is an inhibitor of carbonyl reductase activity in pig’s heart cytosol. A useful research chemical.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29143900 |
