A4809812
Harmaline , >98.0%(HPLC) , 304-21-2
Synonym(s):
1-Methyl-7-methoxy-3,4-dihydro-β-carboline;3,4-Dihydroharmine;4,9-Dihydro-7-methoxy-1-methyl-3H-pyrido[3,4-b]indole;Dihydroharmine;Harmalol methyl ether
CAS NO.:304-21-2
Empirical Formula: C13H14N2O
Molecular Weight: 214.26
MDL number: MFCD00004955
EINECS: 206-152-6
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB31.20 | In Stock |
|
| 100mg | RMB79.20 | In Stock |
|
| 250MG | RMB145.60 | In Stock |
|
| 1G | RMB479.20 | In Stock |
|
| 5G | RMB1439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 232-234 °C(lit.) |
| Boiling point: | 354.4°C (rough estimate) |
| alpha | ±0° |
| Density | 1.0850 (rough estimate) |
| refractive index | 1.6450 (estimate) |
| storage temp. | -10 to -25°C |
| Water Solubility | Slightly soluble in water |
| solubility | DMF: 1.4 mg/ml; DMF:PBS(pH 7.2)(1:1): 0.5 mg/ml; DMSO: 0.25 mg/ml; Ethanol: 0.5 mg/ml |
| form | powder |
| pka | 4.2(at 25℃) |
| color | Light orange to Yellow to Green |
| Merck | 14,4613 |
| BRN | 207310 |
| InChI | 1S/C13H14N2O/c1-8-13-11(5-6-14-8)10-4-3-9(16-2)7-12(10)15-13/h3-4,7,15H,5-6H2,1-2H3 |
| InChIKey | RERZNCLIYCABFS-UHFFFAOYSA-N |
| SMILES | COc1ccc2c3CCN=C(C)c3[nH]c2c1 |
| LogP | 2.251 (est) |
| CAS DataBase Reference | 304-21-2(CAS DataBase Reference) |
| NIST Chemistry Reference | Harmaline(304-21-2) |
| EPA Substance Registry System | 3H-Pyrido[3,4-b]indole, 4,9-dihydro-7-methoxy-1-methyl- (304-21-2) |
Description and Uses
CNS stimulant; may act through NMDA receptors. Reversible inhibitor of MAO-A
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H371 |
| Precautionary statements | P260-P264-P270-P301+P312-P308+P311-P405 |
| target organs | Eyes,Central nervous system |
| Hazard Codes | Xn |
| Risk Statements | 25-20/21/22 |
| Safety Statements | 22-24/25-36 |
| RIDADR | 1544 |
| WGK Germany | 3 |
| RTECS | UU9800000 |
| HS Code | 2939.80.0000 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| Hazardous Substances Data | 304-21-2(Hazardous Substances Data) |






