A4826212
1<i>H</i>,1<i>H</i>-Heptadecafluoro-1-nonanol , >97.0%(GC) , 423-56-3
CAS NO.：423-56-3
Empirical Formula: C9H3F17O
Molecular Weight: 450.09
MDL number: MFCD00153183
EINECS: 670-435-4
| Pack Size | Price | Stock | Quantity |
| 1G | RMB79.20 | In Stock |
|
| 5G | RMB279.20 | In Stock |
|
| 25g | RMB1175.20 | In Stock |
|
| 100g | RMB4399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 66-69 °C (lit.) |
| Boiling point: | 176 °C/740 mmHg (lit.) |
| Density | 1.6660 (estimate) |
| Flash point: | 176°C |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 12.88±0.10(Predicted) |
| color | White to Off-White |
| Water Solubility | Insoluble in water. |
| BRN | 1809099 |
| InChI | 1S/C9H3F17O/c10-2(11,1-27)3(12,13)4(14,15)5(16,17)6(18,19)7(20,21)8(22,23)9(24,25)26/h27H,1H2 |
| InChIKey | BSXJTDJJVULBTQ-UHFFFAOYSA-N |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 423-56-3(CAS DataBase Reference) |
| EPA Substance Registry System | 8:1 Fluorotelomer alcohol (423-56-3) |
Description and Uses
1H,1H-Perfluoro-1-nonanol is used to produce other chemicals. For example, it is used to produce Trifluoro-methanesulfonic acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoro-nonyl ester. This reaction needs reagent Pyridine and solvent CHCl3
Safety
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H318-H351-H360D-H362-H372 |
| Precautionary statements | P260-P263-P280-P304+P340+P312-P305+P351+P338-P308+P313 |
| target organs | Liver |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29055900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |
