PRODUCT Properties
| Melting point: | 248-252 °C(lit.) |
| form | solid |
| InChI | 1S/C15H10O3/c16-11-6-7-12-13(10-4-2-1-3-5-10)9-15(17)18-14(12)8-11/h1-9,16H |
| InChIKey | IVJMJRRORVMRJJ-UHFFFAOYSA-N |
| SMILES | Oc1ccc2c(OC(=O)C=C2c3ccccc3)c1 |
Description and Uses
7-Hydroxy-4-phenylcoumarin is a dual ALDH-2 and MAO inhibitor, with IC50 values of 1.5 and 0.5 μM, respectively[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362-P403+P233-P501 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | C,Xi |
| Risk Statements | 34-36/37/38 |
| Safety Statements | 26-27-36/37/39-37/39-45 |
| WGK Germany | 3 |
| HS Code | 2914409000 |
| Storage Class | 11 - Combustible Solids |
