PRODUCT Properties
| Melting point: | 227-233 °C (lit.) |
| Boiling point: | 535.5±19.0 °C(Predicted) |
| Density | 1.443 |
| storage temp. | Store at -20°C |
| solubility | DMSO: 250 mg/mL (983.32 mM) |
| pka | 7.09±0.20(Predicted) |
| form | Solid |
| color | Light yellow to yellow |
| InChI | InChI=1S/C15H10O4/c16-10-6-12(17)15-11(9-4-2-1-3-5-9)8-14(18)19-13(15)7-10/h1-8,16-17H |
| InChIKey | HUQKUJNSVHEHIH-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(O)=CC(O)=C2C(C2=CC=CC=C2)=C1 |
Description and Uses
LC3-mHTT-IN-AN2 (Compound AN2) is a mHTT-LC3 linker compound, which interacts with both mutant huntingtin protein (mHTT) and LC3B but not with wtHTT or irrelevant control proteins. LC3-mHTT-IN-AN2 reduces the levels of mHTT in an allele-selective manner in cultured Huntington disease (HD) mouse neurons[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




