A4940112
1-Hydroxybutan-2-one , 95% , 5077-67-8
CAS NO.：5077-67-8
Empirical Formula: C4H8O2
Molecular Weight: 88.11
MDL number: MFCD00010259
EINECS: 225-790-6
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB154.40 | In Stock |
|
| 1G | RMB320.00 | In Stock |
|
| 5g | RMB972.00 | In Stock |
|
| 10g | RMB1624.80 | In Stock |
|
| 25g | RMB3051.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 15°C (estimate) |
| Boiling point: | 160.05°C |
| Density | 1.0272 |
| refractive index | 1.4189 |
| FEMA | 3173 | 1-HYDROXY-2-BUTANONE |
| storage temp. | 2-8°C |
| pka | 12.96±0.10(Predicted) |
| form | Liquid |
| color | Colorless to light yellow |
| Odor | at 10.00 % in dipropylene glycol. sweet coffee musty grain malt butterscotch |
| Odor Type | coffee |
| JECFA Number | 1717 |
| InChI | InChI=1S/C4H8O2/c1-2-4(6)3-5/h5H,2-3H2,1H3 |
| InChIKey | GFAZHVHNLUBROE-UHFFFAOYSA-N |
| SMILES | C(O)C(=O)CC |
| LogP | -0.25 |
| EPA Substance Registry System | 2-Butanone, 1-hydroxy- (5077-67-8) |
Description and Uses
May be synthesized from l-chlorobutan-2-one by hydrolysis or by heating the chloro compound with potassium formate in methanol; the ethyl ester may be prepared by bacterial oxidation of the corresponding glycol with Aspergillus niger.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H315-H319-H335 |
| Precautionary statements | P210-P261-P303+P361+P353-P305+P351+P338-P405-P501 |
| RIDADR | 1993 |
| HazardClass | 3.2 |
| PackingGroup | III |
