A4989712
4'-Iodoacetophenone , 98% , 13329-40-3
CAS NO.：13329-40-3
Empirical Formula: C8H7IO
Molecular Weight: 246.05
MDL number: MFCD00045320
EINECS: 236-372-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB42.40 | In Stock |
|
| 25G | RMB108.00 | In Stock |
|
| 100G | RMB384.80 | In Stock |
|
| 500g | RMB1679.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-84 °C(lit.) |
| Boiling point: | 142-144 °C(Press: 12 Torr) |
| Density | 1.7411 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| color | Pale brown to brown |
| Water Solubility | Easily soluble in water. |
| Sensitive | Light Sensitive |
| BRN | 1857412 |
| InChI | InChI=1S/C8H7IO/c1-6(10)7-2-4-8(9)5-3-7/h2-5H,1H3 |
| InChIKey | JZJWCDQGIPQBAO-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(I)C=C1)C |
| CAS DataBase Reference | 13329-40-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Iodoacetophenone(13329-40-3) |
Description and Uses
Synthesis of quinoline-based potential anticancer agents. Substrate for palladium-catalyzed coupling reactions
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29147090 |
