A4992312
5,6-Isopropylidene-L-ascorbic acid , 97% , 15042-01-0
Synonym(s):
(+)-5,6-O-Isopropylidene-L -ascorbic acid
| Pack Size | Price | Stock | Quantity |
| 5G | RMB290.00 | In Stock |
|
| 10g | RMB539.60 | In Stock |
|
| 25G | RMB1241.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 217 °C (dec.) |
| alpha | 10.5 º (c=5%, MeOH) |
| Boiling point: | 395.2±42.0 °C(Predicted) |
| Density | 1.518±0.06 g/cm3(Predicted) |
| refractive index | 10 ° (C=5, MeOH) |
| storage temp. | 2-8°C |
| solubility | Acetone, DMSO, Ethanol, Methanol |
| form | Solid |
| pka | 3.99±0.10(Predicted) |
| color | Off-White |
| optical activity | [α]19/D +25.3°, c = 1 in H2O |
| BRN | 86893 |
| InChI | InChI=1S/C9H12O6/c1-9(2)13-3-4(15-9)7-5(10)6(11)8(12)14-7/h4,7,10-11H,3H2,1-2H3/t4-,7+/m0/s1 |
| InChIKey | POXUQBFHDHCZAD-MHTLYPKNSA-N |
| SMILES | OC1=C(O)C(=O)O[C@@H]1[C@@H]1COC(O1)(C)C |
| CAS DataBase Reference | 15042-01-0(CAS DataBase Reference) |
Description and Uses
5,6-O-Isopropylidene-L-ascorbic acid (L-Ascorbic acid 5,6-acetonide) is an organic compound. 5,6-O-Isopropylidene-L-ascorbic acid is a derivative of L-Ascorbic acid (vitamin C). Ascorbic acid has antioxidant properties.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |




