PRODUCT Properties
| Melting point: | >160°C (dec.) |
| Boiling point: | 565.5±60.0 °C(Predicted) |
| Density | 2.52±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) |
| pka | 13.48±0.70(Predicted) |
| form | Crystalline or Powder |
| color | White to Off-white |
| Sensitive | Light Sensitive |
| Stability: | Light Sensitive |
| InChI | InChI=1S/C9H12IN3O5/c10-3-1-13(9(17)12-7(3)11)8-6(16)5(15)4(2-14)18-8/h1,4-6,8,14-16H,2H2,(H2,11,12,17)/t4-,5-,6-,8-/m1/s1 |
| InChIKey | LQQGJDJXUSAEMZ-UAKXSSHOSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C=C(I)C(N)=NC2=O)[C@H](O)[C@@H]1O |
Description and Uses
5-Iodocytidine is an intermediate for research in the field of nucleic acids and nucleic acid-protein interactions
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Safety Statements | 24/25 |
| HS Code | 29389090 |
