PRODUCT Properties
| Melting point: | 53-56 °C(lit.) |
| Boiling point: | 111°C 1mm |
| Density | 1.8886 (estimate) |
| Flash point: | 110 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Methanol[soluble in] |
| solubility | soluble in Methanol |
| form | Glistening Powder |
| color | Orange-brown |
| InChI | 1S/C7H6INO2/c1-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| InChIKey | DKYCDXAZCHMPSJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(I)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 5326-39-6(CAS DataBase Reference) |
Description and Uses
4-Iodo-3-nitrotoluene may be used in the preparation of:
- 3-cyano-4-iodotoluene
- 4,6′-dimethyl-2 ,2′-dinitrobiphenyl
- bis(2-nitro-4-methylphenyl) sulfide
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-22 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29049090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
