A5055412
(<I>S</I>)-Boc-4-chloro-β-Homophe-OH , ≥98.0% , 270596-42-4
Synonym(s):
(S)-3-(Boc-amino)-4-(4-chlorophenyl)butyric acid;Boc-4-chloro-L -β-homophenylalanine
CAS NO.：270596-42-4
Empirical Formula: C15H20ClNO4
Molecular Weight: 313.78
MDL number: MFCD01318372
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB37.60 | In Stock |
|
| 250MG | RMB114.40 | In Stock |
|
| 1G | RMB417.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 470.0±40.0 °C(Predicted) |
| Density | 1.220±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | solid |
| pka | 4.40±0.10(Predicted) |
| Appearance | White to off-white Solid |
| Major Application | peptide synthesis |
| InChI | 1S/C15H20ClNO4/c1-15(2,3)21-14(20)17-12(9-13(18)19)8-10-4-6-11(16)7-5-10/h4-7,12H,8-9H2,1-3H3,(H,17,20)(H,18,19)/t12-/m0/s1 |
| InChIKey | XHNLLTGZBXJRGH-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(O)=O)Cc1ccc(Cl)cc1 |
| CAS DataBase Reference | 270596-42-4(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
