A5082112
3-Iodopropionic Acid , >98.0%(GC) , 141-76-4
CAS NO.：141-76-4
Empirical Formula: C3H5IO2
Molecular Weight: 199.98
MDL number: MFCD00002765
EINECS: 205-499-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB47.20 | In Stock |
|
| 5G | RMB191.20 | In Stock |
|
| 25G | RMB559.20 | In Stock |
|
| 100g | RMB1360.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 80-83 °C (lit.) |
| Boiling point: | 259.7±23.0 °C(Predicted) |
| Density | 1.9815 (estimate) |
| storage temp. | 2-8°C, protect from light |
| pka | pK1:4.08 (25°C) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Water Solubility | 74.3g/L(25 ºC) |
| Sensitive | Light Sensitive |
| BRN | 1699514 |
| InChI | InChI=1S/C3H5IO2/c4-2-1-3(5)6/h1-2H2,(H,5,6) |
| InChIKey | KMRNTNDWADEIIX-UHFFFAOYSA-N |
| SMILES | C(O)(=O)CCI |
| CAS DataBase Reference | 141-76-4(CAS DataBase Reference) |
| EPA Substance Registry System | Propanoic acid, 3-iodo- (141-76-4) |
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P301+P330+P331-P303+P361+P353-P305+P351+P338+P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | UF4900000 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |
