A5126812
<I>N</I>-<WBR>(Diphenylmethyl)<WBR>methylamine , 97.0%(GC) , 14683-47-7
Synonym(s):
N-Methylbenzhydrylamine
CAS NO.:14683-47-7
Empirical Formula: C14H15N
Molecular Weight: 197.28
MDL number: MFCD00467853
EINECS: 628-491-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB127.20 | In Stock |
|
| 5G | RMB439.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 38-42 °C |
| Boiling point: | 168 °C(Press: 20 Torr) |
| Density | 1.012±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| pka | 8.76±0.20(Predicted) |
| form | crystals |
| color | white cystalline chunk(s) |
| BRN | 2096409 |
| InChI | InChI=1S/C14H15N/c1-15-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11,14-15H,1H3 |
| InChIKey | SHDMMLFAFLZUEV-UHFFFAOYSA-N |
| SMILES | C(NC)(C1=CC=CC=C1)C1=CC=CC=C1 |
Description and Uses
N-(Diphenylmethyl)methylamine is a sterically hindered secondary amine. It participates in the synthesis of cyclooctene oxide.
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3259 8/PG 3 |
| WGK Germany | 3 |
| F | 10-34 |
| HazardClass | IRRITANT |
| HS Code | 2921490090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |







