A5140712
(<I>R</I>)<WBR>-<WBR>(+)<WBR>-<WBR>4-<WBR>Benzyl-<WBR>5,5-<WBR>dimethyl-<WBR>2-<WBR>oxazolidinone , 98% , 204851-73-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB306.40 | In Stock |
|
| 500MG | RMB719.20 | In Stock |
|
| 1g | RMB1148.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 60-62 °C(lit.) |
| Boiling point: | 385.0±9.0 °C(Predicted) |
| Density | 1.085±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 12.86±0.60(Predicted) |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D +96°, c = 2 in chloroform |
| InChI | 1S/C12H15NO2/c1-12(2)10(13-11(14)15-12)8-9-6-4-3-5-7-9/h3-7,10H,8H2,1-2H3,(H,13,14)/t10-/m1/s1 |
| InChIKey | AEEGFEJKONZGOH-SNVBAGLBSA-N |
| SMILES | CC1(C)OC(=O)N[C@@H]1Cc2ccccc2 |
Description and Uses
Versatile chiral auxiliary for asymmetric synthesis used in diastereoselective Michael additions.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





