A5146412
(<I>R</I>)-(−)-6-Methoxy-α-methyl-2-naphthaleneacetic acid , 98% , 23979-41-1
Synonym(s):
(R)-(−)-6-Methoxy-α-methyl-2-naphthaleneacetic acid;(R)-Naproxen;(2R)-2-(6-Methoxy-2-naphthyl)propionic acid;(2R)-2-(6-Methoxynaphthalen-2-yl)propanoic acid;Naproxen Impurity G
CAS NO.：23979-41-1
Empirical Formula: C14H14O3
Molecular Weight: 230.26
MDL number: MFCD00870716
EINECS: 245-966-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB65.60 | In Stock |
|
| 1g | RMB192.00 | In Stock |
|
| 5G | RMB570.40 | In Stock |
|
| 10g | RMB920.00 | In Stock |
|
| 25g | RMB1998.40 | In Stock |
|
| 100g | RMB7152.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 156-158 °C(lit.) |
| Boiling point: | 403.9±20.0 °C(Predicted) |
| Density | 1?+-.0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | solid |
| pka | 4.84±0.30(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D 66°, c = 1% in chloroform |
| InChI | 1S/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | CMWTZPSULFXXJA-SECBINFHSA-N |
| SMILES | COc1ccc2cc(ccc2c1)[C@@H](C)C(O)=O |
Description and Uses
An anti-inflammatory, analgesic, antipyretic. A non-steroidal anti-inflammatory
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 36/37 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29189900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral |
