A5150212
Imidazo[1,2-<I>a</I>]pyrazine , 97% , 274-79-3
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB35.20 | In Stock |
|
| 1g | RMB89.60 | In Stock |
|
| 5g | RMB354.40 | In Stock |
|
| 25g | RMB1396.00 | In Stock |
|
| 100g | RMB3475.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-94 °C |
| Density | 1.29 |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.30±0.30(Predicted) |
| form | solid |
| color | dark brown |
| InChI | InChI=1S/C6H5N3/c1-3-9-4-2-8-6(9)5-7-1/h1-5H |
| InChIKey | MBVAHHOKMIRXLP-UHFFFAOYSA-N |
| SMILES | C12=NC=CN1C=CN=C2 |
Description and Uses
Imidazo[1,2-a]pyrazine is a biochemical reagent that can be used as a biological material or organic compound for life science related research[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H317-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |

![Imidazo[1,2-<I>a</I>]pyrazine](https://img.chemicalbook.com/CAS/GIF/274-79-3.gif)

![Imidazo[1,2-a]pyrazine-2-carboxylic acid](https://img.chemicalbook.com/CAS/GIF/77112-53-9.gif)

