A5158612
(1<I>R</I>)-(−)-Nopol , 98% , 35836-73-8
Synonym(s):
(−)-Nopol;(1R)-6,6-Dimethylbicyclo[3.1.1]hept-2-ene-2-ethanol;6,6-Dimethyl-2-norpinene-2-ethanol;6,6-Dimethylbicyclo[3.1.1]hept-2-ene-2-ethanol
CAS NO.:35836-73-8
Empirical Formula: C11H18O
Molecular Weight: 166.26
MDL number: MFCD00075187
EINECS: 252-744-2
| Pack Size | Price | Stock | Quantity |
| 5ml | RMB31.20 | In Stock |
|
| 25ml | RMB79.20 | In Stock |
|
| 50ML | RMB140.00 | In Stock |
|
| 100ML | RMB255.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 235-236 °C(lit.) |
| Density | 0.973 g/mL at 25 °C(lit.) |
| vapor pressure | 2.17Pa at 20℃ |
| refractive index | n |
| Flash point: | 210 °F |
| storage temp. | Refrigerator, under inert atmosphere |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 15.03±0.10(Predicted) |
| form | Oil |
| color | Clear Colourless |
| optical activity | [α]24/D 37°, neat |
| Water Solubility | 333.5mg/L at 20℃ |
| Merck | 14,6683 |
| BRN | 3196379 |
| InChI | 1S/C11H18O/c1-11(2)9-4-3-8(5-6-12)10(11)7-9/h3,9-10,12H,4-7H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | ROKSAUSPJGWCSM-UWVGGRQHSA-N |
| SMILES | CC1(C)[C@H]2CC=C(CCO)[C@@H]1C2 |
| LogP | 3.09 at 30℃ |
Description and Uses
(1R)-(-)-Nopol can be used as spices and the source of an optically pure fused cyclopentadienyl ligand.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | RC8870000 |
| HS Code | 29061900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





