β-NADP-Na , 93% , 1184-16-3
Synonym(s):
β-Nicotinamide adenine dinucleotide phosphate disodium salt;β-NADH phosphate disodium salt;β-NADP-Na2;β-Nicotinamide-adenine Dinucleotide Phosphate, TPN, Co II, Na;Triphosphopyridine nucleotide disodium salt
CAS NO.:1184-16-3
Empirical Formula: C21H27N7NaO17P3
Molecular Weight: 765.39
MDL number: MFCD00036973
EINECS: 214-664-6
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB23.20 | In Stock |
|
| 500mg | RMB79.20 | In Stock |
|
| 1g | RMB127.20 | In Stock |
|
| 5g | RMB479.20 | In Stock |
|
| 25g | RMB1599.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | 175-178 °C (dec.)(lit.) |
| storage temp. | -20°C |
| solubility | H2O: 50 mg/mL |
| form | powder |
| color | off-white to yellow |
| PH | 2.0-4.0 |
| Water Solubility | Soluble in water. |
| Merck | 14,6344 |
| BRN | 4779954 |
| InChIKey | JNUMDLCHLVUHFS-QYZPTAICSA-M |
| SMILES | [Na+].[H]O[H].NC(=O)c1ccc[n+](c1)C2O[C@H](COP([O-])(=O)OP([O-])(=O)OC[C@H]3O[C@H]([C@@H]([C@@H]3O)P(O)(O)=O)n4cnc5c(N)ncnc45)[C@@H](O)[C@H]2O |
Description and Uses
NADP sodium salt is a cofactor used in anabolic reactions, such as the Calvin cycle and lipid and nucleic acid syntheses, which require NADPH as a reducing agent ('hydrogen source').It is used by all forms of cellular life.
β-Nicotinamide adenine dinucleotide 2′-phosphate (NADP+) and β-Nicotinamide adenine dinucleotide 2′-phosphate, reduced (NADPH) comprise a coenzyme redox pair (NADP+:NADPH) involved in a wide range of enzyme catalyzed oxidation reduction reactions.
β-Nicotinamide Adenine Dinucleotide Phosphate Sodium Salt Hydrate is a substrate NADP which plays a role in a variety of metabolic processes.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36-36/37/38 |
| Safety Statements | 22-24/25-37/39-36-26 |
| WGK Germany | 3 |
| RTECS | UU3440000 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |





